C20H29IrN4- — CID 58068034
3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclopentyl-4H-pyridin-4-ide;iridium (PubChem CID 58068034) has the molecular formula C20H29IrN4- and a molecular weight of 517.70 g/mol. Its IUPAC name is 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclopentyl-4H-pyridin-4-ide;iridium.
| Compound Name | 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclopentyl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 58068034 |
| Molecular Formula | C20H29IrN4- |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 3-[4,5-bis(2-methylpropyl)-1,2,4-triazol-3-yl]-2-cyclopentyl-4H-pyridin-4-ide;iridium |
| SMILES | CC(C)Cc1nnc(-c2[c-]ccnc2C2CCCC2)n1CC(C)C.[Ir] |
| InChI | InChI=1S/C20H29N4.Ir/c1-14(2)12-18-22-23-20(24(18)13-15(3)4)17-10-7-11-21-19(17)16-8-5-6-9-16;/h7,11,14-16H,5-6,8-9,12-13H2,1-4H3;/q-1; |
| InChIKey | UMNAYPFUGQRMGA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|