About 1-methoxypentan-3-imine;tris(yttrium)
1-methoxypentan-3-imine;tris(yttrium) (PubChem CID 58069452) has the molecular formula C6H12NOY3-
and a molecular weight of 380.89 g/mol. Its IUPAC name is 1-methoxypentan-3-imine;tris(yttrium).
Molecular Properties
| Compound Name | 1-methoxypentan-3-imine;tris(yttrium) |
| PubChem CID | 58069452 |
| Molecular Formula | C6H12NOY3- |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.81 |
| IUPAC Name | 1-methoxypentan-3-imine;tris(yttrium) |
| SMILES | [H]/N=C(/C[CH2-])CCOC.[Y].[Y].[Y] |
| InChI | InChI=1S/C6H12NO.3Y/c1-3-6(7)4-5-8-2;;;/h7H,1,3-5H2,2H3;;;/q-1;;;/b7-6-;;; |
| InChIKey | CZXOOHRNOXKFBI-YYFHNNNUSA-N |
| XLogP | 1.26 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypentan-3-imine;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypentan-3-imine;tris(yttrium)?
The IUPAC name of 1-methoxypentan-3-imine;tris(yttrium) (CID 58069452) is 1-methoxypentan-3-imine;tris(yttrium).
What is the SMILES notation for 1-methoxypentan-3-imine;tris(yttrium)?
The canonical SMILES for 1-methoxypentan-3-imine;tris(yttrium) is [H]/N=C(/C[CH2-])CCOC.[Y].[Y].[Y].
What is the InChIKey of 1-methoxypentan-3-imine;tris(yttrium)?
The InChIKey is CZXOOHRNOXKFBI-YYFHNNNUSA-N. The full InChI is InChI=1S/C6H12NO.3Y/c1-3-6(7)4-5-8-2;;;/h7H,1,3-5H2,2H3;;;/q-1;;;/b7-6-;;;.
What are the key properties of 1-methoxypentan-3-imine;tris(yttrium)?
1-methoxypentan-3-imine;tris(yttrium) has a molecular weight of 380.89 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypentan-3-imine;tris(yttrium) is sourced from PubChem (CID 58069452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).