About 1-methoxypentane-2,4-diimine
1-methoxypentane-2,4-diimine (PubChem CID 138709464) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-methoxypentane-2,4-diimine.
Molecular Properties
| Compound Name | 1-methoxypentane-2,4-diimine |
| PubChem CID | 138709464 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1-methoxypentane-2,4-diimine |
| SMILES | [H]/N=C(\COC)C/C(C)=N/[H] |
| InChI | InChI=1S/C6H12N2O/c1-5(7)3-6(8)4-9-2/h7-8H,3-4H2,1-2H3/b7-5+,8-6- |
| InChIKey | JPFPMAUAALLHOG-YMBWGVAGSA-N |
| XLogP | 1.08 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypentane-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypentane-2,4-diimine?
The IUPAC name of 1-methoxypentane-2,4-diimine (CID 138709464) is 1-methoxypentane-2,4-diimine.
What is the SMILES notation for 1-methoxypentane-2,4-diimine?
The canonical SMILES for 1-methoxypentane-2,4-diimine is [H]/N=C(\COC)C/C(C)=N/[H].
What is the InChIKey of 1-methoxypentane-2,4-diimine?
The InChIKey is JPFPMAUAALLHOG-YMBWGVAGSA-N. The full InChI is InChI=1S/C6H12N2O/c1-5(7)3-6(8)4-9-2/h7-8H,3-4H2,1-2H3/b7-5+,8-6-.
What are the key properties of 1-methoxypentane-2,4-diimine?
1-methoxypentane-2,4-diimine has a molecular weight of 128.17 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypentane-2,4-diimine is sourced from PubChem (CID 138709464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).