C13H20O3 — CID 58070902
cis-(1R,2S)-2-(2-oxohex-5-enyl)cyclohexane-1-carboxylic acid (PubChem CID 58070902) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-oxohex-5-enyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-(2-oxohex-5-enyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58070902 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | cis-(1R,2S)-2-(2-oxohex-5-enyl)cyclohexane-1-carboxylic acid |
| SMILES | C=CCCC(=O)C[C@@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H20O3/c1-2-3-7-11(14)9-10-6-4-5-8-12(10)13(15)16/h2,10,12H,1,3-9H2,(H,15,16)/t10-,12+/m0/s1 |
| InChIKey | QPFOCAZGLJZBNG-CMPLNLGQSA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|