C17H26N2O2 — CID 58071138
(2S,5S)-2-[(2S)-butan-2-yl]-5-(methylamino)-4-oxo-6-phenylhexanamide (PubChem CID 58071138) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2S,5S)-2-[(2S)-butan-2-yl]-5-(methylamino)-4-oxo-6-phenylhexanamide.
| Compound Name | (2S,5S)-2-[(2S)-butan-2-yl]-5-(methylamino)-4-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 58071138 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2S,5S)-2-[(2S)-butan-2-yl]-5-(methylamino)-4-oxo-6-phenylhexanamide |
| SMILES | CC[C@H](C)[C@H](CC(=O)[C@H](Cc1ccccc1)NC)C(N)=O |
| InChI | InChI=1S/C17H26N2O2/c1-4-12(2)14(17(18)21)11-16(20)15(19-3)10-13-8-6-5-7-9-13/h5-9,12,14-15,19H,4,10-11H2,1-3H3,(H2,18,21)/t12-,14-,15-/m0/s1 |
| InChIKey | VUBKTOUAXGKUSD-QEJZJMRPSA-N |
| XLogP | 1.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |