C22H14F4N2O2 — CID 58073752
1,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzimidazole-4-carboxylic acid (PubChem CID 58073752) has the molecular formula C22H14F4N2O2 and a molecular weight of 414.36 g/mol. Its IUPAC name is 1,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzimidazole-4-carboxylic acid.
| Compound Name | 1,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58073752 |
| Molecular Formula | C22H14F4N2O2 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1,6-dimethyl-2-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3c(F)c(F)c(-c4ccccc4)c(F)c3F)n(C)c2c1 |
| InChI | InChI=1S/C22H14F4N2O2/c1-10-8-12(22(29)30)20-13(9-10)28(2)21(27-20)15-18(25)16(23)14(17(24)19(15)26)11-6-4-3-5-7-11/h3-9H,1-2H3,(H,29,30) |
| InChIKey | QTKKKBKUZVXQLJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|