C19H10F4N2O2S — CID 58073793
6-methyl-2-(2,3,5,6-tetrafluoro-4-thiophen-3-ylphenyl)-1H-benzimidazole-4-carboxylic acid (PubChem CID 58073793) has the molecular formula C19H10F4N2O2S and a molecular weight of 406.36 g/mol. Its IUPAC name is 6-methyl-2-(2,3,5,6-tetrafluoro-4-thiophen-3-ylphenyl)-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-methyl-2-(2,3,5,6-tetrafluoro-4-thiophen-3-ylphenyl)-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58073793 |
| Molecular Formula | C19H10F4N2O2S |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 6-methyl-2-(2,3,5,6-tetrafluoro-4-thiophen-3-ylphenyl)-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3c(F)c(F)c(-c4ccsc4)c(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C19H10F4N2O2S/c1-7-4-9(19(26)27)17-10(5-7)24-18(25-17)12-15(22)13(20)11(14(21)16(12)23)8-2-3-28-6-8/h2-6H,1H3,(H,24,25)(H,26,27) |
| InChIKey | LZTRVMALDGSOEQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|