C29H28FN3O5S — CID 58074338
N-[(1R)-1-(4-fluorophenyl)ethyl]-4-[[3-nitro-4-(2-phenylethynyl)phenyl]sulfonylamino]cyclohexane-1-carboxamide (PubChem CID 58074338) has the molecular formula C29H28FN3O5S and a molecular weight of 549.62 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-4-[[3-nitro-4-(2-phenylethynyl)phenyl]sulfonylamino]cyclohexane-1-carboxamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-4-[[3-nitro-4-(2-phenylethynyl)phenyl]sulfonylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58074338 |
| Molecular Formula | C29H28FN3O5S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-4-[[3-nitro-4-(2-phenylethynyl)phenyl]sulfonylamino]cyclohexane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc(C#Cc3ccccc3)c([N+](=O)[O-])c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H28FN3O5S/c1-20(22-9-14-25(30)15-10-22)31-29(34)24-11-16-26(17-12-24)32-39(37,38)27-18-13-23(28(19-27)33(35)36)8-7-21-5-3-2-4-6-21/h2-6,9-10,13-15,18-20,24,26,32H,11-12,16-17H2,1H3,(H,31,34)/t20-,24?,26?/m1/s1 |
| InChIKey | VGVKZHVBGJBFLE-ZLGIUERISA-N |
| XLogP | 4.85 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|