C28H29FN2O3S — CID 90216895
4-(9H-fluoren-2-ylsulfonylamino)-N-[(1R)-1-(4-fluorophenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 90216895) has the molecular formula C28H29FN2O3S and a molecular weight of 492.62 g/mol. Its IUPAC name is 4-(9H-fluoren-2-ylsulfonylamino)-N-[(1R)-1-(4-fluorophenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(9H-fluoren-2-ylsulfonylamino)-N-[(1R)-1-(4-fluorophenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90216895 |
| Molecular Formula | C28H29FN2O3S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-(9H-fluoren-2-ylsulfonylamino)-N-[(1R)-1-(4-fluorophenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc3c(c2)Cc2ccccc2-3)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H29FN2O3S/c1-18(19-6-10-23(29)11-7-19)30-28(32)20-8-12-24(13-9-20)31-35(33,34)25-14-15-27-22(17-25)16-21-4-2-3-5-26(21)27/h2-7,10-11,14-15,17-18,20,24,31H,8-9,12-13,16H2,1H3,(H,30,32)/t18-,20?,24?/m1/s1 |
| InChIKey | BKYXCTDQCOOMLE-NWKXHEKXSA-N |
| XLogP | 5.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |