C23H26FN3O3S — CID 58074371
N-[(1R)-1-(4-fluorophenyl)ethyl]-4-(1H-indol-5-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 58074371) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-4-(1H-indol-5-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-4-(1H-indol-5-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58074371 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-4-(1H-indol-5-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc3[nH]ccc3c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O3S/c1-15(16-2-6-19(24)7-3-16)26-23(28)17-4-8-20(9-5-17)27-31(29,30)21-10-11-22-18(14-21)12-13-25-22/h2-3,6-7,10-15,17,20,25,27H,4-5,8-9H2,1H3,(H,26,28)/t15-,17?,20?/m1/s1 |
| InChIKey | OVIIVOIVDNUDDP-XRTORIHISA-N |
| XLogP | 4.02 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |