C33H50F2N2O9 — CID 58075937
[(2R,3S)-13-(2,5-difluorophenyl)-1-hydroxy-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxotridecan-3-yl] acetate (PubChem CID 58075937) has the molecular formula C33H50F2N2O9 and a molecular weight of 656.76 g/mol. Its IUPAC name is [(2R,3S)-13-(2,5-difluorophenyl)-1-hydroxy-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxotridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-13-(2,5-difluorophenyl)-1-hydroxy-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxotridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58075937 |
| Molecular Formula | C33H50F2N2O9 |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | [(2R,3S)-13-(2,5-difluorophenyl)-1-hydroxy-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxotridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)CCC(C)(C)CCC(=O)CC(Cc1cc(F)ccc1F)NC(=O)OC(C)(C)C)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H50F2N2O9/c1-20(39)44-28(26(19-38)37-30(43)46-32(5,6)7)27(41)13-15-33(8,9)14-12-24(40)18-23(36-29(42)45-31(2,3)4)17-21-16-22(34)10-11-25(21)35/h10-11,16,23,26,28,38H,12-15,17-19H2,1-9H3,(H,36,42)(H,37,43)/t23?,26-,28+/m1/s1 |
| InChIKey | UVHJLELHLPBJJJ-ZRLNXTAHSA-N |
| XLogP | 5.33 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|