C17H23NO6 — CID 58076464
[2-(1-acetyloxyethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] acetate (PubChem CID 58076464) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [2-(1-acetyloxyethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] acetate.
| Compound Name | [2-(1-acetyloxyethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] acetate |
|---|---|
| PubChem CID | 58076464 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(1-acetyloxyethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(NC(=O)OC(C)(C)C)cc1C(C)OC(C)=O |
| InChI | InChI=1S/C17H23NO6/c1-10(22-11(2)19)14-9-13(7-8-15(14)23-12(3)20)18-16(21)24-17(4,5)6/h7-10H,1-6H3,(H,18,21) |
| InChIKey | QNYLZWKJVGWKTR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|