C21H34N2O6 — CID 134948264
tert-butyl N-[(1S,2S)-1-methoxy-2-[2-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propyl]carbamate (PubChem CID 134948264) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-methoxy-2-[2-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-methoxy-2-[2-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 134948264 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-methoxy-2-[2-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propyl]carbamate |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)cc1[C@H](C)[C@@H](NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C21H34N2O6/c1-13(17(27-9)23-19(25)29-21(5,6)7)15-12-14(10-11-16(15)26-8)22-18(24)28-20(2,3)4/h10-13,17H,1-9H3,(H,22,24)(H,23,25)/t13-,17-/m0/s1 |
| InChIKey | BAMQMVUTWGOPFM-GUYCJALGSA-N |
| XLogP | 4.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|