C20H25N2S+ — CID 58077953
2-[4-[(E)-1-(4-pyrrolidin-1-ylphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethanethiol (PubChem CID 58077953) has the molecular formula C20H25N2S+ and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-[4-[(E)-1-(4-pyrrolidin-1-ylphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethanethiol.
| Compound Name | 2-[4-[(E)-1-(4-pyrrolidin-1-ylphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethanethiol |
|---|---|
| PubChem CID | 58077953 |
| Molecular Formula | C20H25N2S+ |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[4-[(E)-1-(4-pyrrolidin-1-ylphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethanethiol |
| SMILES | C/C(=C\c1ccc(N2CCCC2)cc1)c1cc[n+](CCS)cc1 |
| InChI | InChI=1S/C20H24N2S/c1-17(19-8-12-21(13-9-19)14-15-23)16-18-4-6-20(7-5-18)22-10-2-3-11-22/h4-9,12-13,16H,2-3,10-11,14-15H2,1H3/p+1 |
| InChIKey | CMLRWAIXOAUFFP-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|