C16H21N — CID 170180536
1-[4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]phenyl]pyrrolidine (PubChem CID 170180536) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-[4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]phenyl]pyrrolidine.
| Compound Name | 1-[4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 170180536 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-[4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]phenyl]pyrrolidine |
| SMILES | C=C(C)/C(C)=C\c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N/c1-13(2)14(3)12-15-6-8-16(9-7-15)17-10-4-5-11-17/h6-9,12H,1,4-5,10-11H2,2-3H3/b14-12- |
| InChIKey | YSCYUXVOBYNEKP-OWBHPGMISA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|