C22H25N9O — CID 58081590
3-methyl-6-[(4-methylphenyl)methyl]-9-pentyl-7-(1,2,4-triazol-4-yl)-[1,2,4]triazolo[4,3-a]purin-5-one (PubChem CID 58081590) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-methyl-6-[(4-methylphenyl)methyl]-9-pentyl-7-(1,2,4-triazol-4-yl)-[1,2,4]triazolo[4,3-a]purin-5-one.
| Compound Name | 3-methyl-6-[(4-methylphenyl)methyl]-9-pentyl-7-(1,2,4-triazol-4-yl)-[1,2,4]triazolo[4,3-a]purin-5-one |
|---|---|
| PubChem CID | 58081590 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-methyl-6-[(4-methylphenyl)methyl]-9-pentyl-7-(1,2,4-triazol-4-yl)-[1,2,4]triazolo[4,3-a]purin-5-one |
| SMILES | CCCCCn1c2nc(-n3cnnc3)n(Cc3ccc(C)cc3)c2c(=O)n2c(C)nnc12 |
| InChI | InChI=1S/C22H25N9O/c1-4-5-6-11-29-19-18(20(32)31-16(3)26-27-22(29)31)30(12-17-9-7-15(2)8-10-17)21(25-19)28-13-23-24-14-28/h7-10,13-14H,4-6,11-12H2,1-3H3 |
| InChIKey | NZVNHBJERJLSOJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|