C15H16F5N5O — CID 58081679
12-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one (PubChem CID 58081679) has the molecular formula C15H16F5N5O and a molecular weight of 377.32 g/mol. Its IUPAC name is 12-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one.
| Compound Name | 12-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 58081679 |
| Molecular Formula | C15H16F5N5O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 12-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
| SMILES | CCCCCn1c2c(c(=O)n3c(C)nnc13)CC(C(F)(F)C(F)(F)F)=N2 |
| InChI | InChI=1S/C15H16F5N5O/c1-3-4-5-6-24-11-9(12(26)25-8(2)22-23-13(24)25)7-10(21-11)14(16,17)15(18,19)20/h3-7H2,1-2H3 |
| InChIKey | NCWOQGLTONYTGF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|