C47H54O4 — CID 58085028
[4-[4-[4-(4-octylbenzoyl)oxyphenyl]cyclopenta-1,3-dien-1-yl]phenyl] 4-octylbenzoate (PubChem CID 58085028) has the molecular formula C47H54O4 and a molecular weight of 682.95 g/mol. Its IUPAC name is [4-[4-[4-(4-octylbenzoyl)oxyphenyl]cyclopenta-1,3-dien-1-yl]phenyl] 4-octylbenzoate.
| Compound Name | [4-[4-[4-(4-octylbenzoyl)oxyphenyl]cyclopenta-1,3-dien-1-yl]phenyl] 4-octylbenzoate |
|---|---|
| PubChem CID | 58085028 |
| Molecular Formula | C47H54O4 |
| Molecular Weight | 682.95 g/mol |
| Exact Mass | 682.40 |
| IUPAC Name | [4-[4-[4-(4-octylbenzoyl)oxyphenyl]cyclopenta-1,3-dien-1-yl]phenyl] 4-octylbenzoate |
| SMILES | CCCCCCCCc1ccc(C(=O)Oc2ccc(C3=CC=C(c4ccc(OC(=O)c5ccc(CCCCCCCC)cc5)cc4)C3)cc2)cc1 |
| InChI | InChI=1S/C47H54O4/c1-3-5-7-9-11-13-15-36-17-21-40(22-18-36)46(48)50-44-31-27-38(28-32-44)42-25-26-43(35-42)39-29-33-45(34-30-39)51-47(49)41-23-19-37(20-24-41)16-14-12-10-8-6-4-2/h17-34H,3-16,35H2,1-2H3 |
| InChIKey | RVPQUKNLHGUVIA-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.95 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|