(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate

C26H32O2 — CID 7033411

IUPAC(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate
SMILESCCCCCCc1ccc(OC(=O)c2ccc(C3=CC[C@H](C)CC3)cc2)cc1
InChIInChI=1S/C26H32O2/c1-3-4-5-6-7-21-10-18-25(19-11-21)28-26(27)24-16-14-23(15-17-24)22-12-8-20(2)9-13-22/h10-12,14-20H,3-9,13H2,1-2H3/t20-/m0/s1
InChIKeyNDUCYHUIBLFFMN-FQEVSTJZSA-N
MW376.54 g/mol
LogP7.23
Rot. Bonds8

About (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate

(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate (PubChem CID 7033411) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate.

Molecular Properties

Compound Name(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate
PubChem CID7033411
Molecular FormulaC26H32O2
Molecular Weight376.54 g/mol
Exact Mass376.24
IUPAC Name(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate
SMILESCCCCCCc1ccc(OC(=O)c2ccc(C3=CC[C@H](C)CC3)cc2)cc1
InChIInChI=1S/C26H32O2/c1-3-4-5-6-7-21-10-18-25(19-11-21)28-26(27)24-16-14-23(15-17-24)22-12-8-20(2)9-13-22/h10-12,14-20H,3-9,13H2,1-2H3/t20-/m0/s1
InChIKeyNDUCYHUIBLFFMN-FQEVSTJZSA-N
XLogP7.23
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.54
LogP ≤ 57.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate?
The IUPAC name of (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate (CID 7033411) is (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate.
What is the SMILES notation for (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate?
The canonical SMILES for (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate is CCCCCCc1ccc(OC(=O)c2ccc(C3=CC[C@H](C)CC3)cc2)cc1.
What is the InChIKey of (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate?
The InChIKey is NDUCYHUIBLFFMN-FQEVSTJZSA-N. The full InChI is InChI=1S/C26H32O2/c1-3-4-5-6-7-21-10-18-25(19-11-21)28-26(27)24-16-14-23(15-17-24)22-12-8-20(2)9-13-22/h10-12,14-20H,3-9,13H2,1-2H3/t20-/m0/s1.
What are the key properties of (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate?
(4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate has a molecular weight of 376.54 g/mol, XLogP of 7.23, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexylphenyl) 4-[(4R)-4-methylcyclohexen-1-yl]benzoate is sourced from PubChem (CID 7033411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).