C32H33NO4 — CID 58090206
[4-[4-[(1-hydroxy-2-methylpropoxy)methyl]-N-naphthalen-2-ylanilino]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 58090206) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is [4-[4-[(1-hydroxy-2-methylpropoxy)methyl]-N-naphthalen-2-ylanilino]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-[(1-hydroxy-2-methylpropoxy)methyl]-N-naphthalen-2-ylanilino]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58090206 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [4-[4-[(1-hydroxy-2-methylpropoxy)methyl]-N-naphthalen-2-ylanilino]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(N(c2ccc(COC(O)C(C)C)cc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C32H33NO4/c1-22(2)31(34)36-20-24-9-14-28(15-10-24)33(30-18-13-26-7-5-6-8-27(26)19-30)29-16-11-25(12-17-29)21-37-32(35)23(3)4/h5-19,23,32,35H,1,20-21H2,2-4H3 |
| InChIKey | LWEIZMXRZRTAKD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|