C24H20Cl2N4O — CID 58090716
4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 58090716) has the molecular formula C24H20Cl2N4O and a molecular weight of 451.36 g/mol. Its IUPAC name is 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58090716 |
| Molecular Formula | C24H20Cl2N4O |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(Cc3cccc(Cl)c3)nc(Cc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O/c1-31-21-10-8-20(9-11-21)27-24-29-22(14-16-4-2-6-18(25)12-16)28-23(30-24)15-17-5-3-7-19(26)13-17/h2-13H,14-15H2,1H3,(H,27,28,29,30) |
| InChIKey | QVJTXMMXDFIPKW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |