C27H34Cl2N4O3 — CID 58098214
N-[4-[[(1S,2S)-2-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]cyclopropyl]methyl]-9-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl]acetamide (PubChem CID 58098214) has the molecular formula C27H34Cl2N4O3 and a molecular weight of 533.50 g/mol. Its IUPAC name is N-[4-[[(1S,2S)-2-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]cyclopropyl]methyl]-9-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl]acetamide.
| Compound Name | N-[4-[[(1S,2S)-2-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]cyclopropyl]methyl]-9-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl]acetamide |
|---|---|
| PubChem CID | 58098214 |
| Molecular Formula | C27H34Cl2N4O3 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[4-[[(1S,2S)-2-[[4-(2,3-dichlorophenyl)piperazin-1-yl]methyl]cyclopropyl]methyl]-9-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl]acetamide |
| SMILES | CC(=O)NC1C(C)C2CC1C1C(=O)N(C[C@H]3C[C@@H]3CN3CCN(c4cccc(Cl)c4Cl)CC3)C(=O)C21 |
| InChI | InChI=1S/C27H34Cl2N4O3/c1-14-18-11-19(25(14)30-15(2)34)23-22(18)26(35)33(27(23)36)13-17-10-16(17)12-31-6-8-32(9-7-31)21-5-3-4-20(28)24(21)29/h3-5,14,16-19,22-23,25H,6-13H2,1-2H3,(H,30,34)/t14?,16-,17-,18?,19?,22?,23?,25?/m1/s1 |
| InChIKey | ZTGXMTUPBDKNGA-IGTDXRLMSA-N |
| XLogP | 3.14 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|