C21H23NS3 — CID 58098266
4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophene-2-carbonitrile (PubChem CID 58098266) has the molecular formula C21H23NS3 and a molecular weight of 385.62 g/mol. Its IUPAC name is 4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophene-2-carbonitrile.
| Compound Name | 4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 58098266 |
| Molecular Formula | C21H23NS3 |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophene-2-carbonitrile |
| SMILES | CCCCc1ccsc1-c1ccc(-c2sc(C#N)cc2CCCC)s1 |
| InChI | InChI=1S/C21H23NS3/c1-3-5-7-15-11-12-23-20(15)18-9-10-19(25-18)21-16(8-6-4-2)13-17(14-22)24-21/h9-13H,3-8H2,1-2H3 |
| InChIKey | UJBZCURXNLDWDR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |