C46H48N2O2S6 — CID 70803813
1,4-bis[4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 70803813) has the molecular formula C46H48N2O2S6 and a molecular weight of 853.30 g/mol. Its IUPAC name is 1,4-bis[4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis[4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 70803813 |
| Molecular Formula | C46H48N2O2S6 |
| Molecular Weight | 853.30 g/mol |
| Exact Mass | 852.20 |
| IUPAC Name | 1,4-bis[4-butyl-5-[5-(3-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCc1ccsc1-c1ccc(-c2sc(C3=C4C(=O)NC(c5cc(CCCC)c(-c6ccc(-c7sccc7CCCC)s6)s5)=C4C(=O)N3)cc2CCCC)s1 |
| InChI | InChI=1S/C46H48N2O2S6/c1-5-9-13-27-21-23-51-41(27)31-17-19-33(53-31)43-29(15-11-7-3)25-35(55-43)39-37-38(46(50)47-39)40(48-45(37)49)36-26-30(16-12-8-4)44(56-36)34-20-18-32(54-34)42-28(14-10-6-2)22-24-52-42/h17-26H,5-16H2,1-4H3,(H,47,50)(H,48,49) |
| InChIKey | DWHPBZPZGPRTME-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.30 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|