C40H42O10 — CID 58099910
[4-(5-propa-1,2-dienylperoxypentoxy)phenyl] 6-[4-[1-[3-(2-methoxyethoxy)propoxy]ethenyl]benzoyl]oxynaphthalene-2-carboxylate (PubChem CID 58099910) has the molecular formula C40H42O10 and a molecular weight of 682.77 g/mol. Its IUPAC name is [4-(5-propa-1,2-dienylperoxypentoxy)phenyl] 6-[4-[1-[3-(2-methoxyethoxy)propoxy]ethenyl]benzoyl]oxynaphthalene-2-carboxylate.
| Compound Name | [4-(5-propa-1,2-dienylperoxypentoxy)phenyl] 6-[4-[1-[3-(2-methoxyethoxy)propoxy]ethenyl]benzoyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58099910 |
| Molecular Formula | C40H42O10 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | [4-(5-propa-1,2-dienylperoxypentoxy)phenyl] 6-[4-[1-[3-(2-methoxyethoxy)propoxy]ethenyl]benzoyl]oxynaphthalene-2-carboxylate |
| SMILES | C=C=COOCCCCCOc1ccc(OC(=O)c2ccc3cc(OC(=O)c4ccc(C(=C)OCCCOCCOC)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C40H42O10/c1-4-21-47-48-25-7-5-6-23-46-36-17-19-37(20-18-36)49-40(42)35-14-13-34-29-38(16-15-33(34)28-35)50-39(41)32-11-9-31(10-12-32)30(2)45-24-8-22-44-27-26-43-3/h9-21,28-29H,1-2,5-8,22-27H2,3H3 |
| InChIKey | JJIPZOFOIITHLB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|