C38H40O10 — CID 58690147
[6-[[4-(4-propa-1,2-dienylperoxybutoxy)phenoxy]methoxy]naphthalen-2-yl] 4-[4-[(E)-prop-1-enyl]peroxybutoxy]benzoate (PubChem CID 58690147) has the molecular formula C38H40O10 and a molecular weight of 656.73 g/mol. Its IUPAC name is [6-[[4-(4-propa-1,2-dienylperoxybutoxy)phenoxy]methoxy]naphthalen-2-yl] 4-[4-[(E)-prop-1-enyl]peroxybutoxy]benzoate.
| Compound Name | [6-[[4-(4-propa-1,2-dienylperoxybutoxy)phenoxy]methoxy]naphthalen-2-yl] 4-[4-[(E)-prop-1-enyl]peroxybutoxy]benzoate |
|---|---|
| PubChem CID | 58690147 |
| Molecular Formula | C38H40O10 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | [6-[[4-(4-propa-1,2-dienylperoxybutoxy)phenoxy]methoxy]naphthalen-2-yl] 4-[4-[(E)-prop-1-enyl]peroxybutoxy]benzoate |
| SMILES | C=C=COOCCCCOc1ccc(OCOc2ccc3cc(OC(=O)c4ccc(OCCCCOO/C=C/C)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C38H40O10/c1-3-21-44-46-25-7-5-23-40-33-13-9-30(10-14-33)38(39)48-37-16-12-31-27-36(15-11-32(31)28-37)43-29-42-35-19-17-34(18-20-35)41-24-6-8-26-47-45-22-4-2/h3,9-22,27-28H,2,5-8,23-26,29H2,1H3/b21-3+ |
| InChIKey | GIUBITZALRWIOH-WSVFEZOKSA-N |
| XLogP | 8.52 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|