C13H18F5NO5S2 — CID 58100488
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-(trifluoromethylsulfonylmethylsulfonyl)ethanone (PubChem CID 58100488) has the molecular formula C13H18F5NO5S2 and a molecular weight of 427.41 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-(trifluoromethylsulfonylmethylsulfonyl)ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-(trifluoromethylsulfonylmethylsulfonyl)ethanone |
|---|---|
| PubChem CID | 58100488 |
| Molecular Formula | C13H18F5NO5S2 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2-difluoro-2-(trifluoromethylsulfonylmethylsulfonyl)ethanone |
| SMILES | O=C(N1CCCC2CCCCC21)C(F)(F)S(=O)(=O)CS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F5NO5S2/c14-12(15,25(21,22)8-26(23,24)13(16,17)18)11(20)19-7-3-5-9-4-1-2-6-10(9)19/h9-10H,1-8H2 |
| InChIKey | MTNSTCIOPHRHCW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |