C27H25NO4 — CID 58101384
(2E)-2-[2-oxo-1-[[4-(4-phenylbutoxy)phenyl]methyl]indol-3-ylidene]acetic acid (PubChem CID 58101384) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2E)-2-[2-oxo-1-[[4-(4-phenylbutoxy)phenyl]methyl]indol-3-ylidene]acetic acid.
| Compound Name | (2E)-2-[2-oxo-1-[[4-(4-phenylbutoxy)phenyl]methyl]indol-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 58101384 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2E)-2-[2-oxo-1-[[4-(4-phenylbutoxy)phenyl]methyl]indol-3-ylidene]acetic acid |
| SMILES | O=C(O)/C=C1/C(=O)N(Cc2ccc(OCCCCc3ccccc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H25NO4/c29-26(30)18-24-23-11-4-5-12-25(23)28(27(24)31)19-21-13-15-22(16-14-21)32-17-7-6-10-20-8-2-1-3-9-20/h1-5,8-9,11-16,18H,6-7,10,17,19H2,(H,29,30)/b24-18+ |
| InChIKey | QTKKDVDTSJXBMJ-HKOYGPOVSA-N |
| XLogP | 5.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|