About 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium
2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium (PubChem CID 58106959) has the molecular formula C15H18N2OOs
and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium.
Molecular Properties
| Compound Name | 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium |
| PubChem CID | 58106959 |
| Molecular Formula | C15H18N2OOs |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium |
| SMILES | CNc1cccc(C(C)(C)c2ccccc2O)n1.[Os] |
| InChI | InChI=1S/C15H18N2O.Os/c1-15(2,11-7-4-5-8-12(11)18)13-9-6-10-14(16-3)17-13;/h4-10,18H,1-3H3,(H,16,17); |
| InChIKey | PGDQPRYJCNHJRC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium?
The IUPAC name of 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium (CID 58106959) is 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium.
What is the SMILES notation for 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium?
The canonical SMILES for 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium is CNc1cccc(C(C)(C)c2ccccc2O)n1.[Os].
What is the InChIKey of 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium?
The InChIKey is PGDQPRYJCNHJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.Os/c1-15(2,11-7-4-5-8-12(11)18)13-9-6-10-14(16-3)17-13;/h4-10,18H,1-3H3,(H,16,17);.
What are the key properties of 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium?
2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium has a molecular weight of 432.55 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[6-(methylamino)-2-pyridinyl]propan-2-yl]phenol;osmium is sourced from PubChem (CID 58106959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).