C27H36N6Pt — CID 59357101
N-(3-imino-4,4-dimethylpent-1-enyl)-6-[2-[6-[(3-imino-4,4-dimethylpent-1-enyl)amino]-2-pyridinyl]propan-2-yl]pyridin-2-amine;platinum(2+) (PubChem CID 59357101) has the molecular formula C27H36N6Pt and a molecular weight of 639.71 g/mol. Its IUPAC name is N-(3-imino-4,4-dimethylpent-1-enyl)-6-[2-[6-[(3-imino-4,4-dimethylpent-1-enyl)amino]-2-pyridinyl]propan-2-yl]pyridin-2-amine;platinum(2+).
| Compound Name | N-(3-imino-4,4-dimethylpent-1-enyl)-6-[2-[6-[(3-imino-4,4-dimethylpent-1-enyl)amino]-2-pyridinyl]propan-2-yl]pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 59357101 |
| Molecular Formula | C27H36N6Pt |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | N-(3-imino-4,4-dimethylpent-1-enyl)-6-[2-[6-[(3-imino-4,4-dimethylpent-1-enyl)amino]-2-pyridinyl]propan-2-yl]pyridin-2-amine;platinum(2+) |
| SMILES | [H]/N=C(/C=[C-]\Nc1cccc(C(C)(C)c2cccc(N/[C-]=C\C(=N\[H])C(C)(C)C)n2)n1)C(C)(C)C.[Pt+2] |
| InChI | InChI=1S/C27H36N6.Pt/c1-25(2,3)19(28)15-17-30-23-13-9-11-21(32-23)27(7,8)22-12-10-14-24(33-22)31-18-16-20(29)26(4,5)6;/h9-16,28-29H,1-8H3,(H,30,32)(H,31,33);/q-2;+2/b28-19-,29-20-; |
| InChIKey | BPUNBRPOHFFANM-MUZCIKGXSA-N |
| XLogP | 6.39 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|