C23H18IrN4O-2 — CID 58107086
iridium;N-[[6-(phenoxy)-2-pyridinyl]methyl]-1-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]methanamine (PubChem CID 58107086) has the molecular formula C23H18IrN4O-2 and a molecular weight of 558.64 g/mol. Its IUPAC name is iridium;N-[[6-(phenoxy)-2-pyridinyl]methyl]-1-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]methanamine.
| Compound Name | iridium;N-[[6-(phenoxy)-2-pyridinyl]methyl]-1-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 58107086 |
| Molecular Formula | C23H18IrN4O-2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | iridium;N-[[6-(phenoxy)-2-pyridinyl]methyl]-1-[6-(4H-pyridin-4-id-3-yl)-2-pyridinyl]methanamine |
| SMILES | [Ir].[c-]1ccccc1Oc1cccc(CNCc2cccc(-c3[c-]ccnc3)n2)n1 |
| InChI | InChI=1S/C23H18N4O.Ir/c1-2-10-21(11-3-1)28-23-13-5-9-20(27-23)17-25-16-19-8-4-12-22(26-19)18-7-6-14-24-15-18;/h1-6,8-10,12-15,25H,16-17H2;/q-2; |
| InChIKey | IMEYSCMRPSIJGI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|