C41H55N5O4S — CID 58107759
(3S)-1-[(2R)-2-[[3-(6-aminohexanoylamino)-1-methylsulfanylcyclopentanecarbonyl]amino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide (PubChem CID 58107759) has the molecular formula C41H55N5O4S and a molecular weight of 713.99 g/mol. Its IUPAC name is (3S)-1-[(2R)-2-[[3-(6-aminohexanoylamino)-1-methylsulfanylcyclopentanecarbonyl]amino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2R)-2-[[3-(6-aminohexanoylamino)-1-methylsulfanylcyclopentanecarbonyl]amino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 58107759 |
| Molecular Formula | C41H55N5O4S |
| Molecular Weight | 713.99 g/mol |
| Exact Mass | 713.40 |
| IUPAC Name | (3S)-1-[(2R)-2-[[3-(6-aminohexanoylamino)-1-methylsulfanylcyclopentanecarbonyl]amino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide |
| SMILES | CCNC(=O)[C@]1(Cc2ccccc2)CCCN(C(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)C2(SC)CCC(NC(=O)CCCCCN)C2)C1 |
| InChI | InChI=1S/C41H55N5O4S/c1-3-43-38(49)40(27-30-13-6-4-7-14-30)21-12-24-46(29-40)37(48)35(26-31-18-19-32-15-9-10-16-33(32)25-31)45-39(50)41(51-2)22-20-34(28-41)44-36(47)17-8-5-11-23-42/h4,6-7,9-10,13-16,18-19,25,34-35H,3,5,8,11-12,17,20-24,26-29,42H2,1-2H3,(H,43,49)(H,44,47)(H,45,50)/t34?,35-,40+,41?/m1/s1 |
| InChIKey | CHWWOCRGJLFTHG-KVAODMFTSA-N |
| XLogP | 5.14 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.99 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|