C39H51N5O5S — CID 58107787
(3S)-1-[(2R)-2-[6-[(2-acetamido-3-sulfanylpropanoyl)amino]hexanoylamino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide (PubChem CID 58107787) has the molecular formula C39H51N5O5S and a molecular weight of 701.93 g/mol. Its IUPAC name is (3S)-1-[(2R)-2-[6-[(2-acetamido-3-sulfanylpropanoyl)amino]hexanoylamino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2R)-2-[6-[(2-acetamido-3-sulfanylpropanoyl)amino]hexanoylamino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 58107787 |
| Molecular Formula | C39H51N5O5S |
| Molecular Weight | 701.93 g/mol |
| Exact Mass | 701.36 |
| IUPAC Name | (3S)-1-[(2R)-2-[6-[(2-acetamido-3-sulfanylpropanoyl)amino]hexanoylamino]-3-naphthalen-2-ylpropanoyl]-3-benzyl-N-ethylpiperidine-3-carboxamide |
| SMILES | CCNC(=O)[C@]1(Cc2ccccc2)CCCN(C(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)CCCCCNC(=O)C(CS)NC(C)=O)C1 |
| InChI | InChI=1S/C39H51N5O5S/c1-3-40-38(49)39(25-29-13-6-4-7-14-29)20-12-22-44(27-39)37(48)33(24-30-18-19-31-15-9-10-16-32(31)23-30)43-35(46)17-8-5-11-21-41-36(47)34(26-50)42-28(2)45/h4,6-7,9-10,13-16,18-19,23,33-34,50H,3,5,8,11-12,17,20-22,24-27H2,1-2H3,(H,40,49)(H,41,47)(H,42,45)(H,43,46)/t33-,34?,39+/m1/s1 |
| InChIKey | MQURCNLBDAVLSQ-GIFPWOASSA-N |
| XLogP | 3.97 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|