C37H38FN5O3 — CID 58111279
(E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclopentyl]-3-(2-fluoroethyl)benzimidazol-5-yl]prop-2-enoic acid (PubChem CID 58111279) has the molecular formula C37H38FN5O3 and a molecular weight of 619.74 g/mol. Its IUPAC name is (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclopentyl]-3-(2-fluoroethyl)benzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclopentyl]-3-(2-fluoroethyl)benzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58111279 |
| Molecular Formula | C37H38FN5O3 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclopentyl]-3-(2-fluoroethyl)benzimidazol-5-yl]prop-2-enoic acid |
| SMILES | Cn1c(-c2ccccn2)c(C2CCCC2)c2ccc(C(=O)NC3(c4nc5ccc(/C=C/C(=O)O)cc5n4CCF)CCCC3)cc21 |
| InChI | InChI=1S/C37H38FN5O3/c1-42-30-23-26(13-14-27(30)33(25-8-2-3-9-25)34(42)29-10-4-7-20-39-29)35(46)41-37(17-5-6-18-37)36-40-28-15-11-24(12-16-32(44)45)22-31(28)43(36)21-19-38/h4,7,10-16,20,22-23,25H,2-3,5-6,8-9,17-19,21H2,1H3,(H,41,46)(H,44,45)/b16-12+ |
| InChIKey | ZRWUQISJAXCEDX-FOWTUZBSSA-N |
| XLogP | 7.51 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|