C20H19F3IN3O2 — CID 58112172
1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-(trifluoromethyl)pyrazol-4-yl]methyl]methanamine (PubChem CID 58112172) has the molecular formula C20H19F3IN3O2 and a molecular weight of 517.29 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-(trifluoromethyl)pyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-(trifluoromethyl)pyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 58112172 |
| Molecular Formula | C20H19F3IN3O2 |
| Molecular Weight | 517.29 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-(trifluoromethyl)pyrazol-4-yl]methyl]methanamine |
| SMILES | COc1ccc(CNCc2cn(-c3ccc(I)cc3)nc2C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C20H19F3IN3O2/c1-28-17-8-3-13(18(9-17)29-2)10-25-11-14-12-27(26-19(14)20(21,22)23)16-6-4-15(24)5-7-16/h3-9,12,25H,10-11H2,1-2H3 |
| InChIKey | XTDUWILSEIGPMS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|