C24H23IN4O2 — CID 59177843
1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-pyridin-4-ylpyrazol-4-yl]methyl]methanamine (PubChem CID 59177843) has the molecular formula C24H23IN4O2 and a molecular weight of 526.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-pyridin-4-ylpyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-pyridin-4-ylpyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 59177843 |
| Molecular Formula | C24H23IN4O2 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-[[1-(4-iodophenyl)-3-pyridin-4-ylpyrazol-4-yl]methyl]methanamine |
| SMILES | COc1ccc(CNCc2cn(-c3ccc(I)cc3)nc2-c2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C24H23IN4O2/c1-30-22-8-3-18(23(13-22)31-2)14-27-15-19-16-29(21-6-4-20(25)5-7-21)28-24(19)17-9-11-26-12-10-17/h3-13,16,27H,14-15H2,1-2H3 |
| InChIKey | PBYYYSWXIKZXQY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|