C27H28IN3O — CID 70312359
1-(2-ethyl-4-methoxyphenyl)-N-[[1-(4-iodo-3-methylphenyl)-3-phenylpyrazol-4-yl]methyl]methanamine (PubChem CID 70312359) has the molecular formula C27H28IN3O and a molecular weight of 537.45 g/mol. Its IUPAC name is 1-(2-ethyl-4-methoxyphenyl)-N-[[1-(4-iodo-3-methylphenyl)-3-phenylpyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-(2-ethyl-4-methoxyphenyl)-N-[[1-(4-iodo-3-methylphenyl)-3-phenylpyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 70312359 |
| Molecular Formula | C27H28IN3O |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 1-(2-ethyl-4-methoxyphenyl)-N-[[1-(4-iodo-3-methylphenyl)-3-phenylpyrazol-4-yl]methyl]methanamine |
| SMILES | CCc1cc(OC)ccc1CNCc1cn(-c2ccc(I)c(C)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H28IN3O/c1-4-20-15-25(32-3)12-10-22(20)16-29-17-23-18-31(24-11-13-26(28)19(2)14-24)30-27(23)21-8-6-5-7-9-21/h5-15,18,29H,4,16-17H2,1-3H3 |
| InChIKey | IGGLDPNBSYMMJE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|