C24H19N2S+ — CID 58113509
5-(2,6-dimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene (PubChem CID 58113509) has the molecular formula C24H19N2S+ and a molecular weight of 367.50 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene.
| Compound Name | 5-(2,6-dimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene |
|---|---|
| PubChem CID | 58113509 |
| Molecular Formula | C24H19N2S+ |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene |
| SMILES | Cc1cccc(C)c1-n1cc[n+]2c1-c1cc3c(cc1C2)sc1ccccc13 |
| InChI | InChI=1S/C24H19N2S/c1-15-6-5-7-16(2)23(15)26-11-10-25-14-17-12-22-20(13-19(17)24(25)26)18-8-3-4-9-21(18)27-22/h3-13H,14H2,1-2H3/q+1 |
| InChIKey | ADPIKOFKYKJMGG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|