About methoxymethyl 4-hydroxybenzoate
methoxymethyl 4-hydroxybenzoate (PubChem CID 58114704) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is methoxymethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | methoxymethyl 4-hydroxybenzoate |
| PubChem CID | 58114704 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | methoxymethyl 4-hydroxybenzoate |
| SMILES | COCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c1-12-6-13-9(11)7-2-4-8(10)5-3-7/h2-5,10H,6H2,1H3 |
| InChIKey | XZRGHORRENYUOC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl 4-hydroxybenzoate?
The IUPAC name of methoxymethyl 4-hydroxybenzoate (CID 58114704) is methoxymethyl 4-hydroxybenzoate.
What is the SMILES notation for methoxymethyl 4-hydroxybenzoate?
The canonical SMILES for methoxymethyl 4-hydroxybenzoate is COCOC(=O)c1ccc(O)cc1.
What is the InChIKey of methoxymethyl 4-hydroxybenzoate?
The InChIKey is XZRGHORRENYUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-12-6-13-9(11)7-2-4-8(10)5-3-7/h2-5,10H,6H2,1H3.
What are the key properties of methoxymethyl 4-hydroxybenzoate?
methoxymethyl 4-hydroxybenzoate has a molecular weight of 182.17 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl 4-hydroxybenzoate is sourced from PubChem (CID 58114704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).