C26H38N4O4S — CID 58116370
4-methoxy-N,2,6-trimethyl-N-[2-[[2-oxo-4-(1-pyridin-4-ylpiperidin-4-yl)butyl]amino]ethyl]benzenesulfonamide (PubChem CID 58116370) has the molecular formula C26H38N4O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is 4-methoxy-N,2,6-trimethyl-N-[2-[[2-oxo-4-(1-pyridin-4-ylpiperidin-4-yl)butyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N,2,6-trimethyl-N-[2-[[2-oxo-4-(1-pyridin-4-ylpiperidin-4-yl)butyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58116370 |
| Molecular Formula | C26H38N4O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-methoxy-N,2,6-trimethyl-N-[2-[[2-oxo-4-(1-pyridin-4-ylpiperidin-4-yl)butyl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCNCC(=O)CCC2CCN(c3ccncc3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H38N4O4S/c1-20-17-25(34-4)18-21(2)26(20)35(32,33)29(3)16-13-28-19-24(31)6-5-22-9-14-30(15-10-22)23-7-11-27-12-8-23/h7-8,11-12,17-18,22,28H,5-6,9-10,13-16,19H2,1-4H3 |
| InChIKey | AJSRZQCKUNPVTE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|