C33H32FN7OS — CID 58116927
13-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-[(E)-4-[methyl(propan-2-yl)amino]but-2-enoyl]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile (PubChem CID 58116927) has the molecular formula C33H32FN7OS and a molecular weight of 593.73 g/mol. Its IUPAC name is 13-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-[(E)-4-[methyl(propan-2-yl)amino]but-2-enoyl]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile.
| Compound Name | 13-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-[(E)-4-[methyl(propan-2-yl)amino]but-2-enoyl]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile |
|---|---|
| PubChem CID | 58116927 |
| Molecular Formula | C33H32FN7OS |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 13-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-[(E)-4-[methyl(propan-2-yl)amino]but-2-enoyl]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile |
| SMILES | CC(C)N(C)C/C=C/C(=O)N1CCc2c(sc3ncc(C#N)c(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c23)C1 |
| InChI | InChI=1S/C33H32FN7OS/c1-21(2)39(3)12-5-8-30(42)40-13-11-27-29(20-40)43-33-31(27)32(24(16-35)17-36-33)38-26-9-10-28-23(15-26)18-37-41(28)19-22-6-4-7-25(34)14-22/h4-10,14-15,17-18,21H,11-13,19-20H2,1-3H3,(H,36,38)/b8-5+ |
| InChIKey | LGPPNTOFGJQREB-VMPITWQZSA-N |
| XLogP | 6.23 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|