C27H36F3N3O — CID 58118053
4-methyl-N-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethoxy]cyclohexyl]-3-(trifluoromethyl)aniline (PubChem CID 58118053) has the molecular formula C27H36F3N3O and a molecular weight of 475.60 g/mol. Its IUPAC name is 4-methyl-N-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethoxy]cyclohexyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-methyl-N-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethoxy]cyclohexyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 58118053 |
| Molecular Formula | C27H36F3N3O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 4-methyl-N-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethoxy]cyclohexyl]-3-(trifluoromethyl)aniline |
| SMILES | Cc1ccc(N2CCN(CCOC3CCC(Nc4ccc(C)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36F3N3O/c1-20-3-9-24(10-4-20)33-15-13-32(14-16-33)17-18-34-25-11-7-22(8-12-25)31-23-6-5-21(2)26(19-23)27(28,29)30/h3-6,9-10,19,22,25,31H,7-8,11-18H2,1-2H3 |
| InChIKey | BAUGCTMLXFLBEV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|