C20H14ClFNO5S- — CID 58125230
(3R)-3-(carboxymethyl)-4-[(4-chlorophenyl)methyl]-7-fluoro-1-oxo-2,3-dihydrocyclopenta[b]indole-5-sulfinate (PubChem CID 58125230) has the molecular formula C20H14ClFNO5S- and a molecular weight of 434.85 g/mol. Its IUPAC name is (3R)-3-(carboxymethyl)-4-[(4-chlorophenyl)methyl]-7-fluoro-1-oxo-2,3-dihydrocyclopenta[b]indole-5-sulfinate.
| Compound Name | (3R)-3-(carboxymethyl)-4-[(4-chlorophenyl)methyl]-7-fluoro-1-oxo-2,3-dihydrocyclopenta[b]indole-5-sulfinate |
|---|---|
| PubChem CID | 58125230 |
| Molecular Formula | C20H14ClFNO5S- |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | (3R)-3-(carboxymethyl)-4-[(4-chlorophenyl)methyl]-7-fluoro-1-oxo-2,3-dihydrocyclopenta[b]indole-5-sulfinate |
| SMILES | O=C(O)C[C@H]1CC(=O)c2c1n(Cc1ccc(Cl)cc1)c1c(S(=O)[O-])cc(F)cc21 |
| InChI | InChI=1S/C20H15ClFNO5S/c21-12-3-1-10(2-4-12)9-23-19-11(6-17(25)26)5-15(24)18(19)14-7-13(22)8-16(20(14)23)29(27)28/h1-4,7-8,11H,5-6,9H2,(H,25,26)(H,27,28)/p-1/t11-/m1/s1 |
| InChIKey | UCZHPVYSVWWRBZ-LLVKDONJSA-M |
| XLogP | 3.86 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|