C20H19ClN2O4S — CID 11430048
2-[7-[(4-chlorophenyl)methyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid (PubChem CID 11430048) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is 2-[7-[(4-chlorophenyl)methyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid.
| Compound Name | 2-[7-[(4-chlorophenyl)methyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid |
|---|---|
| PubChem CID | 11430048 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-[7-[(4-chlorophenyl)methyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid |
| SMILES | CS(=O)(=O)c1cncc2c3c(n(Cc4ccc(Cl)cc4)c12)C(CC(=O)O)CC3 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-28(26,27)17-10-22-9-16-15-7-4-13(8-18(24)25)19(15)23(20(16)17)11-12-2-5-14(21)6-3-12/h2-3,5-6,9-10,13H,4,7-8,11H2,1H3,(H,24,25) |
| InChIKey | HYELXHVWRMSXQQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |