C26H22Cl2FNO2S — CID 91505732
1,4-bis[(4-chlorophenyl)methyl]-7-fluoro-5-methylsulfonyl-2,3-dihydro-1H-cyclopenta[b]indole (PubChem CID 91505732) has the molecular formula C26H22Cl2FNO2S and a molecular weight of 502.44 g/mol. Its IUPAC name is 1,4-bis[(4-chlorophenyl)methyl]-7-fluoro-5-methylsulfonyl-2,3-dihydro-1H-cyclopenta[b]indole.
| Compound Name | 1,4-bis[(4-chlorophenyl)methyl]-7-fluoro-5-methylsulfonyl-2,3-dihydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 91505732 |
| Molecular Formula | C26H22Cl2FNO2S |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 1,4-bis[(4-chlorophenyl)methyl]-7-fluoro-5-methylsulfonyl-2,3-dihydro-1H-cyclopenta[b]indole |
| SMILES | CS(=O)(=O)c1cc(F)cc2c3c(n(Cc4ccc(Cl)cc4)c12)CCC3Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22Cl2FNO2S/c1-33(31,32)24-14-21(29)13-22-25-18(12-16-2-7-19(27)8-3-16)6-11-23(25)30(26(22)24)15-17-4-9-20(28)10-5-17/h2-5,7-10,13-14,18H,6,11-12,15H2,1H3 |
| InChIKey | FFMWVDLSPOWGGE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|