C21H21ClN2O4S — CID 11453277
2-[7-[(1S)-1-(4-chlorophenyl)ethyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid (PubChem CID 11453277) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-[7-[(1S)-1-(4-chlorophenyl)ethyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid.
| Compound Name | 2-[7-[(1S)-1-(4-chlorophenyl)ethyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid |
|---|---|
| PubChem CID | 11453277 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[7-[(1S)-1-(4-chlorophenyl)ethyl]-9-methylsulfonyl-7,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-5-yl]acetic acid |
| SMILES | C[C@@H](c1ccc(Cl)cc1)n1c2c(c3cncc(S(C)(=O)=O)c31)CCC2CC(=O)O |
| InChI | InChI=1S/C21H21ClN2O4S/c1-12(13-3-6-15(22)7-4-13)24-20-14(9-19(25)26)5-8-16(20)17-10-23-11-18(21(17)24)29(2,27)28/h3-4,6-7,10-12,14H,5,8-9H2,1-2H3,(H,25,26)/t12-,14?/m0/s1 |
| InChIKey | RITXXAIJEDGYRV-NBFOIZRFSA-N |
| XLogP | 4.21 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |