C17H14BrNO3 — CID 58126345
benzyl 4-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)benzoate (PubChem CID 58126345) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is benzyl 4-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)benzoate.
| Compound Name | benzyl 4-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 58126345 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | benzyl 4-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(C2CC(Br)=NO2)cc1 |
| InChI | InChI=1S/C17H14BrNO3/c18-16-10-15(22-19-16)13-6-8-14(9-7-13)17(20)21-11-12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | WMBNHOLDRWDTNF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |