C18H24N2O4S2 — CID 58129633
2-[[2-hydroxyethyl(methyl)amino]methyl]-1-(3-methyl-4-methylsulfanylphenoxy)-4-(sulfinoamino)benzene (PubChem CID 58129633) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[[2-hydroxyethyl(methyl)amino]methyl]-1-(3-methyl-4-methylsulfanylphenoxy)-4-(sulfinoamino)benzene.
| Compound Name | 2-[[2-hydroxyethyl(methyl)amino]methyl]-1-(3-methyl-4-methylsulfanylphenoxy)-4-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 58129633 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[[2-hydroxyethyl(methyl)amino]methyl]-1-(3-methyl-4-methylsulfanylphenoxy)-4-(sulfinoamino)benzene |
| SMILES | CSc1ccc(Oc2ccc(NS(=O)O)cc2CN(C)CCO)cc1C |
| InChI | InChI=1S/C18H24N2O4S2/c1-13-10-16(5-7-18(13)25-3)24-17-6-4-15(19-26(22)23)11-14(17)12-20(2)8-9-21/h4-7,10-11,19,21H,8-9,12H2,1-3H3,(H,22,23) |
| InChIKey | KRCNQPODSHLYBO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|