C23H16O4 — CID 58130846
[5-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-hydroxyphenyl] formate (PubChem CID 58130846) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [5-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-hydroxyphenyl] formate.
| Compound Name | [5-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-hydroxyphenyl] formate |
|---|---|
| PubChem CID | 58130846 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [5-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-hydroxyphenyl] formate |
| SMILES | O=COc1cc(/C=C/C=C/c2ccc3oc4ccccc4c3c2)ccc1O |
| InChI | InChI=1S/C23H16O4/c24-15-26-23-14-17(9-11-20(23)25)6-2-1-5-16-10-12-22-19(13-16)18-7-3-4-8-21(18)27-22/h1-15,25H/b5-1+,6-2+ |
| InChIKey | VFDZRUYCKQHEFG-IJIVKGSJSA-N |
| XLogP | 5.55 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|