C23H19NO4 — CID 88993589
4-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-(methylperoxyamino)phenol (PubChem CID 88993589) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-(methylperoxyamino)phenol.
| Compound Name | 4-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-(methylperoxyamino)phenol |
|---|---|
| PubChem CID | 88993589 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-[(1E,3E)-4-dibenzofuran-2-ylbuta-1,3-dienyl]-2-(methylperoxyamino)phenol |
| SMILES | COONc1cc(/C=C/C=C/c2ccc3oc4ccccc4c3c2)ccc1O |
| InChI | InChI=1S/C23H19NO4/c1-26-28-24-20-15-17(10-12-21(20)25)7-3-2-6-16-11-13-23-19(14-16)18-8-4-5-9-22(18)27-23/h2-15,24-25H,1H3/b6-2+,7-3+ |
| InChIKey | WCBIHDLNEOIVCC-YPCIICBESA-N |
| XLogP | 5.92 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|